C15H31NO — CID 83138862
2-cyclohexyl-N-(2-methoxyethyl)-3,3-dimethylbutan-1-amine (PubChem CID 83138862) has the molecular formula C15H31NO and a molecular weight of 241.42 g/mol. Its IUPAC name is 2-cyclohexyl-N-(2-methoxyethyl)-3,3-dimethylbutan-1-amine.
| Compound Name | 2-cyclohexyl-N-(2-methoxyethyl)-3,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 83138862 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | 2-cyclohexyl-N-(2-methoxyethyl)-3,3-dimethylbutan-1-amine |
| SMILES | COCCNCC(C1CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C15H31NO/c1-15(2,3)14(12-16-10-11-17-4)13-8-6-5-7-9-13/h13-14,16H,5-12H2,1-4H3 |
| InChIKey | ZYNZOUSYQDDQFI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|