C15H27NS — CID 83139408
3,3-dimethyl-N-propyl-2-(2-thiophen-3-ylethyl)butan-1-amine (PubChem CID 83139408) has the molecular formula C15H27NS and a molecular weight of 253.45 g/mol. Its IUPAC name is 3,3-dimethyl-N-propyl-2-(2-thiophen-3-ylethyl)butan-1-amine.
| Compound Name | 3,3-dimethyl-N-propyl-2-(2-thiophen-3-ylethyl)butan-1-amine |
|---|---|
| PubChem CID | 83139408 |
| Molecular Formula | C15H27NS |
| Molecular Weight | 253.45 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | 3,3-dimethyl-N-propyl-2-(2-thiophen-3-ylethyl)butan-1-amine |
| SMILES | CCCNCC(CCc1ccsc1)C(C)(C)C |
| InChI | InChI=1S/C15H27NS/c1-5-9-16-11-14(15(2,3)4)7-6-13-8-10-17-12-13/h8,10,12,14,16H,5-7,9,11H2,1-4H3 |
| InChIKey | MGHWBVXPMVWZIR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|