C15H30F3NO — CID 83139638
2-tert-butyl-N-(2-methylpropyl)-5-(2,2,2-trifluoroethoxy)pentan-1-amine (PubChem CID 83139638) has the molecular formula C15H30F3NO and a molecular weight of 297.41 g/mol. Its IUPAC name is 2-tert-butyl-N-(2-methylpropyl)-5-(2,2,2-trifluoroethoxy)pentan-1-amine.
| Compound Name | 2-tert-butyl-N-(2-methylpropyl)-5-(2,2,2-trifluoroethoxy)pentan-1-amine |
|---|---|
| PubChem CID | 83139638 |
| Molecular Formula | C15H30F3NO |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | 2-tert-butyl-N-(2-methylpropyl)-5-(2,2,2-trifluoroethoxy)pentan-1-amine |
| SMILES | CC(C)CNCC(CCCOCC(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C15H30F3NO/c1-12(2)9-19-10-13(14(3,4)5)7-6-8-20-11-15(16,17)18/h12-13,19H,6-11H2,1-5H3 |
| InChIKey | FYSMKVZHRPJIFC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|