About 2-methylbutanoic acid
2-methylbutanoic acid (PubChem CID 8314) has the molecular formula C5H10O2
and a molecular weight of 102.13 g/mol. Its IUPAC name is 2-methylbutanoic acid.
Molecular Properties
| Compound Name | 2-methylbutanoic acid |
| PubChem CID | 8314 |
| Molecular Formula | C5H10O2 |
| Molecular Weight | 102.13 g/mol |
| Exact Mass | 102.07 |
| IUPAC Name | 2-methylbutanoic acid |
| SMILES | CCC(C)C(=O)O |
| InChI | InChI=1S/C5H10O2/c1-3-4(2)5(6)7/h4H,3H2,1-2H3,(H,6,7) |
| InChIKey | WLAMNBDJUVNPJU-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.13 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutanoic acid?
The IUPAC name of 2-methylbutanoic acid (CID 8314) is 2-methylbutanoic acid.
What is the SMILES notation for 2-methylbutanoic acid?
The canonical SMILES for 2-methylbutanoic acid is CCC(C)C(=O)O.
What is the InChIKey of 2-methylbutanoic acid?
The InChIKey is WLAMNBDJUVNPJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2/c1-3-4(2)5(6)7/h4H,3H2,1-2H3,(H,6,7).
What are the key properties of 2-methylbutanoic acid?
2-methylbutanoic acid has a molecular weight of 102.13 g/mol, XLogP of 1.12, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutanoic acid is sourced from PubChem (CID 8314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).