About 1-amino-N-(2,3,3-trimethylbutyl)butane-2-sulfonamide
1-amino-N-(2,3,3-trimethylbutyl)butane-2-sulfonamide (PubChem CID 83141468) has the molecular formula C11H26N2O2S
and a molecular weight of 250.41 g/mol. Its IUPAC name is 1-amino-N-(2,3,3-trimethylbutyl)butane-2-sulfonamide.
Molecular Properties
| Compound Name | 1-amino-N-(2,3,3-trimethylbutyl)butane-2-sulfonamide |
| PubChem CID | 83141468 |
| Molecular Formula | C11H26N2O2S |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 1-amino-N-(2,3,3-trimethylbutyl)butane-2-sulfonamide |
| SMILES | CCC(CN)S(=O)(=O)NCC(C)C(C)(C)C |
| InChI | InChI=1S/C11H26N2O2S/c1-6-10(7-12)16(14,15)13-8-9(2)11(3,4)5/h9-10,13H,6-8,12H2,1-5H3 |
| InChIKey | PTGKUCFSWPABDN-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-amino-N-(2,3,3-trimethylbutyl)butane-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-N-(2,3,3-trimethylbutyl)butane-2-sulfonamide?
The IUPAC name of 1-amino-N-(2,3,3-trimethylbutyl)butane-2-sulfonamide (CID 83141468) is 1-amino-N-(2,3,3-trimethylbutyl)butane-2-sulfonamide.
What is the SMILES notation for 1-amino-N-(2,3,3-trimethylbutyl)butane-2-sulfonamide?
The canonical SMILES for 1-amino-N-(2,3,3-trimethylbutyl)butane-2-sulfonamide is CCC(CN)S(=O)(=O)NCC(C)C(C)(C)C.
What is the InChIKey of 1-amino-N-(2,3,3-trimethylbutyl)butane-2-sulfonamide?
The InChIKey is PTGKUCFSWPABDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H26N2O2S/c1-6-10(7-12)16(14,15)13-8-9(2)11(3,4)5/h9-10,13H,6-8,12H2,1-5H3.
What are the key properties of 1-amino-N-(2,3,3-trimethylbutyl)butane-2-sulfonamide?
1-amino-N-(2,3,3-trimethylbutyl)butane-2-sulfonamide has a molecular weight of 250.41 g/mol, XLogP of 1.33, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-N-(2,3,3-trimethylbutyl)butane-2-sulfonamide is sourced from PubChem (CID 83141468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).