C11H20N2O2 — CID 83141889
3-(2,3,3-trimethylbutylamino)pyrrolidine-2,5-dione (PubChem CID 83141889) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is 3-(2,3,3-trimethylbutylamino)pyrrolidine-2,5-dione.
| Compound Name | 3-(2,3,3-trimethylbutylamino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 83141889 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 3-(2,3,3-trimethylbutylamino)pyrrolidine-2,5-dione |
| SMILES | CC(CNC1CC(=O)NC1=O)C(C)(C)C |
| InChI | InChI=1S/C11H20N2O2/c1-7(11(2,3)4)6-12-8-5-9(14)13-10(8)15/h7-8,12H,5-6H2,1-4H3,(H,13,14,15) |
| InChIKey | XFOIBIKWTXGOLO-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|