C15H23ClO2 — CID 83142159
1-[3-(chloromethyl)-4,4-dimethylpentoxy]-2-methoxybenzene (PubChem CID 83142159) has the molecular formula C15H23ClO2 and a molecular weight of 270.80 g/mol. Its IUPAC name is 1-[3-(chloromethyl)-4,4-dimethylpentoxy]-2-methoxybenzene.
| Compound Name | 1-[3-(chloromethyl)-4,4-dimethylpentoxy]-2-methoxybenzene |
|---|---|
| PubChem CID | 83142159 |
| Molecular Formula | C15H23ClO2 |
| Molecular Weight | 270.80 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 1-[3-(chloromethyl)-4,4-dimethylpentoxy]-2-methoxybenzene |
| SMILES | COc1ccccc1OCCC(CCl)C(C)(C)C |
| InChI | InChI=1S/C15H23ClO2/c1-15(2,3)12(11-16)9-10-18-14-8-6-5-7-13(14)17-4/h5-8,12H,9-11H2,1-4H3 |
| InChIKey | BUWAKQZLIVUDFJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.80 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|