C17H24N2O2 — CID 83142351
2-ethyl-3-(2,3,3-trimethylbutyl)benzimidazole-5-carboxylic acid (PubChem CID 83142351) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-ethyl-3-(2,3,3-trimethylbutyl)benzimidazole-5-carboxylic acid.
| Compound Name | 2-ethyl-3-(2,3,3-trimethylbutyl)benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 83142351 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 2-ethyl-3-(2,3,3-trimethylbutyl)benzimidazole-5-carboxylic acid |
| SMILES | CCc1nc2ccc(C(=O)O)cc2n1CC(C)C(C)(C)C |
| InChI | InChI=1S/C17H24N2O2/c1-6-15-18-13-8-7-12(16(20)21)9-14(13)19(15)10-11(2)17(3,4)5/h7-9,11H,6,10H2,1-5H3,(H,20,21) |
| InChIKey | GQONTCUJLILNPV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |