C11H19BrN2 — CID 83142428
3-[2-(bromomethyl)-3,3-dimethylbutyl]-1-methylpyrazole (PubChem CID 83142428) has the molecular formula C11H19BrN2 and a molecular weight of 259.19 g/mol. Its IUPAC name is 3-[2-(bromomethyl)-3,3-dimethylbutyl]-1-methylpyrazole.
| Compound Name | 3-[2-(bromomethyl)-3,3-dimethylbutyl]-1-methylpyrazole |
|---|---|
| PubChem CID | 83142428 |
| Molecular Formula | C11H19BrN2 |
| Molecular Weight | 259.19 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 3-[2-(bromomethyl)-3,3-dimethylbutyl]-1-methylpyrazole |
| SMILES | Cn1ccc(CC(CBr)C(C)(C)C)n1 |
| InChI | InChI=1S/C11H19BrN2/c1-11(2,3)9(8-12)7-10-5-6-14(4)13-10/h5-6,9H,7-8H2,1-4H3 |
| InChIKey | IUUUVPREFBJDKJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.19 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|