About N-cyclopropyl-2-(2,3,3-trimethylbutylamino)benzenesulfonamide
N-cyclopropyl-2-(2,3,3-trimethylbutylamino)benzenesulfonamide (PubChem CID 83142432) has the molecular formula C16H26N2O2S
and a molecular weight of 310.46 g/mol. Its IUPAC name is N-cyclopropyl-2-(2,3,3-trimethylbutylamino)benzenesulfonamide.
Molecular Properties
| Compound Name | N-cyclopropyl-2-(2,3,3-trimethylbutylamino)benzenesulfonamide |
| PubChem CID | 83142432 |
| Molecular Formula | C16H26N2O2S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | N-cyclopropyl-2-(2,3,3-trimethylbutylamino)benzenesulfonamide |
| SMILES | CC(CNc1ccccc1S(=O)(=O)NC1CC1)C(C)(C)C |
| InChI | InChI=1S/C16H26N2O2S/c1-12(16(2,3)4)11-17-14-7-5-6-8-15(14)21(19,20)18-13-9-10-13/h5-8,12-13,17-18H,9-11H2,1-4H3 |
| InChIKey | ATFYYCQXNPXNRH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclopropyl-2-(2,3,3-trimethylbutylamino)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-2-(2,3,3-trimethylbutylamino)benzenesulfonamide?
The IUPAC name of N-cyclopropyl-2-(2,3,3-trimethylbutylamino)benzenesulfonamide (CID 83142432) is N-cyclopropyl-2-(2,3,3-trimethylbutylamino)benzenesulfonamide.
What is the SMILES notation for N-cyclopropyl-2-(2,3,3-trimethylbutylamino)benzenesulfonamide?
The canonical SMILES for N-cyclopropyl-2-(2,3,3-trimethylbutylamino)benzenesulfonamide is CC(CNc1ccccc1S(=O)(=O)NC1CC1)C(C)(C)C.
What is the InChIKey of N-cyclopropyl-2-(2,3,3-trimethylbutylamino)benzenesulfonamide?
The InChIKey is ATFYYCQXNPXNRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2O2S/c1-12(16(2,3)4)11-17-14-7-5-6-8-15(14)21(19,20)18-13-9-10-13/h5-8,12-13,17-18H,9-11H2,1-4H3.
What are the key properties of N-cyclopropyl-2-(2,3,3-trimethylbutylamino)benzenesulfonamide?
N-cyclopropyl-2-(2,3,3-trimethylbutylamino)benzenesulfonamide has a molecular weight of 310.46 g/mol, XLogP of 3.22, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-2-(2,3,3-trimethylbutylamino)benzenesulfonamide is sourced from PubChem (CID 83142432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).