C12H27NO2 — CID 83142750
N-(1,1-dimethoxypropan-2-yl)-2,3,3-trimethylbutan-1-amine (PubChem CID 83142750) has the molecular formula C12H27NO2 and a molecular weight of 217.35 g/mol. Its IUPAC name is N-(1,1-dimethoxypropan-2-yl)-2,3,3-trimethylbutan-1-amine.
| Compound Name | N-(1,1-dimethoxypropan-2-yl)-2,3,3-trimethylbutan-1-amine |
|---|---|
| PubChem CID | 83142750 |
| Molecular Formula | C12H27NO2 |
| Molecular Weight | 217.35 g/mol |
| Exact Mass | 217.20 |
| IUPAC Name | N-(1,1-dimethoxypropan-2-yl)-2,3,3-trimethylbutan-1-amine |
| SMILES | COC(OC)C(C)NCC(C)C(C)(C)C |
| InChI | InChI=1S/C12H27NO2/c1-9(12(3,4)5)8-13-10(2)11(14-6)15-7/h9-11,13H,8H2,1-7H3 |
| InChIKey | FUELJSSEIXGRBS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|