C11H17Cl2N3 — CID 83143505
3,6-dichloro-N-(2,3,3-trimethylbutyl)pyridazin-4-amine (PubChem CID 83143505) has the molecular formula C11H17Cl2N3 and a molecular weight of 262.18 g/mol. Its IUPAC name is 3,6-dichloro-N-(2,3,3-trimethylbutyl)pyridazin-4-amine.
| Compound Name | 3,6-dichloro-N-(2,3,3-trimethylbutyl)pyridazin-4-amine |
|---|---|
| PubChem CID | 83143505 |
| Molecular Formula | C11H17Cl2N3 |
| Molecular Weight | 262.18 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 3,6-dichloro-N-(2,3,3-trimethylbutyl)pyridazin-4-amine |
| SMILES | CC(CNc1cc(Cl)nnc1Cl)C(C)(C)C |
| InChI | InChI=1S/C11H17Cl2N3/c1-7(11(2,3)4)6-14-8-5-9(12)15-16-10(8)13/h5,7H,6H2,1-4H3,(H,14,15) |
| InChIKey | AEBQLKSMCJIPNM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.18 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |