About N-carbamoyl-2-(2,3,3-trimethylbutylamino)propanamide
N-carbamoyl-2-(2,3,3-trimethylbutylamino)propanamide (PubChem CID 83144225) has the molecular formula C11H23N3O2
and a molecular weight of 229.32 g/mol. Its IUPAC name is N-carbamoyl-2-(2,3,3-trimethylbutylamino)propanamide.
Molecular Properties
| Compound Name | N-carbamoyl-2-(2,3,3-trimethylbutylamino)propanamide |
| PubChem CID | 83144225 |
| Molecular Formula | C11H23N3O2 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | N-carbamoyl-2-(2,3,3-trimethylbutylamino)propanamide |
| SMILES | CC(NCC(C)C(C)(C)C)C(=O)NC(N)=O |
| InChI | InChI=1S/C11H23N3O2/c1-7(11(3,4)5)6-13-8(2)9(15)14-10(12)16/h7-8,13H,6H2,1-5H3,(H3,12,14,15,16) |
| InChIKey | NYWSRROMFRYADA-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-carbamoyl-2-(2,3,3-trimethylbutylamino)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-carbamoyl-2-(2,3,3-trimethylbutylamino)propanamide?
The IUPAC name of N-carbamoyl-2-(2,3,3-trimethylbutylamino)propanamide (CID 83144225) is N-carbamoyl-2-(2,3,3-trimethylbutylamino)propanamide.
What is the SMILES notation for N-carbamoyl-2-(2,3,3-trimethylbutylamino)propanamide?
The canonical SMILES for N-carbamoyl-2-(2,3,3-trimethylbutylamino)propanamide is CC(NCC(C)C(C)(C)C)C(=O)NC(N)=O.
What is the InChIKey of N-carbamoyl-2-(2,3,3-trimethylbutylamino)propanamide?
The InChIKey is NYWSRROMFRYADA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3O2/c1-7(11(3,4)5)6-13-8(2)9(15)14-10(12)16/h7-8,13H,6H2,1-5H3,(H3,12,14,15,16).
What are the key properties of N-carbamoyl-2-(2,3,3-trimethylbutylamino)propanamide?
N-carbamoyl-2-(2,3,3-trimethylbutylamino)propanamide has a molecular weight of 229.32 g/mol, XLogP of 0.84, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-carbamoyl-2-(2,3,3-trimethylbutylamino)propanamide is sourced from PubChem (CID 83144225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).