About 2-bromo-4-(trifluoromethyl)-N-(2,3,3-trimethylbutyl)aniline
2-bromo-4-(trifluoromethyl)-N-(2,3,3-trimethylbutyl)aniline (PubChem CID 83144259) has the molecular formula C14H19BrF3N
and a molecular weight of 338.21 g/mol. Its IUPAC name is 2-bromo-4-(trifluoromethyl)-N-(2,3,3-trimethylbutyl)aniline.
Molecular Properties
| Compound Name | 2-bromo-4-(trifluoromethyl)-N-(2,3,3-trimethylbutyl)aniline |
| PubChem CID | 83144259 |
| Molecular Formula | C14H19BrF3N |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 2-bromo-4-(trifluoromethyl)-N-(2,3,3-trimethylbutyl)aniline |
| SMILES | CC(CNc1ccc(C(F)(F)F)cc1Br)C(C)(C)C |
| InChI | InChI=1S/C14H19BrF3N/c1-9(13(2,3)4)8-19-12-6-5-10(7-11(12)15)14(16,17)18/h5-7,9,19H,8H2,1-4H3 |
| InChIKey | ZZDXSHLHJIGLMJ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-bromo-4-(trifluoromethyl)-N-(2,3,3-trimethylbutyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-(trifluoromethyl)-N-(2,3,3-trimethylbutyl)aniline?
The IUPAC name of 2-bromo-4-(trifluoromethyl)-N-(2,3,3-trimethylbutyl)aniline (CID 83144259) is 2-bromo-4-(trifluoromethyl)-N-(2,3,3-trimethylbutyl)aniline.
What is the SMILES notation for 2-bromo-4-(trifluoromethyl)-N-(2,3,3-trimethylbutyl)aniline?
The canonical SMILES for 2-bromo-4-(trifluoromethyl)-N-(2,3,3-trimethylbutyl)aniline is CC(CNc1ccc(C(F)(F)F)cc1Br)C(C)(C)C.
What is the InChIKey of 2-bromo-4-(trifluoromethyl)-N-(2,3,3-trimethylbutyl)aniline?
The InChIKey is ZZDXSHLHJIGLMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19BrF3N/c1-9(13(2,3)4)8-19-12-6-5-10(7-11(12)15)14(16,17)18/h5-7,9,19H,8H2,1-4H3.
What are the key properties of 2-bromo-4-(trifluoromethyl)-N-(2,3,3-trimethylbutyl)aniline?
2-bromo-4-(trifluoromethyl)-N-(2,3,3-trimethylbutyl)aniline has a molecular weight of 338.21 g/mol, XLogP of 5.56, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-(trifluoromethyl)-N-(2,3,3-trimethylbutyl)aniline is sourced from PubChem (CID 83144259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).