C13H29N3O — CID 83144600
N'-hydroxy-2,2-dimethyl-4-(2,3,3-trimethylbutylamino)butanimidamide (PubChem CID 83144600) has the molecular formula C13H29N3O and a molecular weight of 243.39 g/mol. Its IUPAC name is N'-hydroxy-2,2-dimethyl-4-(2,3,3-trimethylbutylamino)butanimidamide.
| Compound Name | N'-hydroxy-2,2-dimethyl-4-(2,3,3-trimethylbutylamino)butanimidamide |
|---|---|
| PubChem CID | 83144600 |
| Molecular Formula | C13H29N3O |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.23 |
| IUPAC Name | N'-hydroxy-2,2-dimethyl-4-(2,3,3-trimethylbutylamino)butanimidamide |
| SMILES | CC(CNCCC(C)(C)C(N)=NO)C(C)(C)C |
| InChI | InChI=1S/C13H29N3O/c1-10(12(2,3)4)9-15-8-7-13(5,6)11(14)16-17/h10,15,17H,7-9H2,1-6H3,(H2,14,16) |
| InChIKey | ZOVUPRPQMDPROB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|