C13H23NO3S — CID 83145180
(2S)-3-methyl-2-[[2-(thian-4-yl)acetyl]amino]pentanoic acid (PubChem CID 83145180) has the molecular formula C13H23NO3S and a molecular weight of 273.40 g/mol. Its IUPAC name is (2S)-3-methyl-2-[[2-(thian-4-yl)acetyl]amino]pentanoic acid.
| Compound Name | (2S)-3-methyl-2-[[2-(thian-4-yl)acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 83145180 |
| Molecular Formula | C13H23NO3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | (2S)-3-methyl-2-[[2-(thian-4-yl)acetyl]amino]pentanoic acid |
| SMILES | CCC(C)[C@H](NC(=O)CC1CCSCC1)C(=O)O |
| InChI | InChI=1S/C13H23NO3S/c1-3-9(2)12(13(16)17)14-11(15)8-10-4-6-18-7-5-10/h9-10,12H,3-8H2,1-2H3,(H,14,15)(H,16,17)/t9?,12-/m0/s1 |
| InChIKey | HBJIHJDFPZOEQB-ACGXKRRESA-N |
| XLogP | 2.14 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |