C16H14BrNOS — CID 83145829
2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethoxy)-5-bromobenzenecarbothioamide (PubChem CID 83145829) has the molecular formula C16H14BrNOS and a molecular weight of 348.27 g/mol. Its IUPAC name is 2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethoxy)-5-bromobenzenecarbothioamide.
| Compound Name | 2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethoxy)-5-bromobenzenecarbothioamide |
|---|---|
| PubChem CID | 83145829 |
| Molecular Formula | C16H14BrNOS |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | 2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethoxy)-5-bromobenzenecarbothioamide |
| SMILES | NC(=S)c1cc(Br)ccc1OCC1Cc2ccccc21 |
| InChI | InChI=1S/C16H14BrNOS/c17-12-5-6-15(14(8-12)16(18)20)19-9-11-7-10-3-1-2-4-13(10)11/h1-6,8,11H,7,9H2,(H2,18,20) |
| InChIKey | XJPUIISIXLMZKD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|