C13H23NO3S — CID 83146101
2-[ethyl-[2-(thian-4-yl)acetyl]amino]-2-methylpropanoic acid (PubChem CID 83146101) has the molecular formula C13H23NO3S and a molecular weight of 273.40 g/mol. Its IUPAC name is 2-[ethyl-[2-(thian-4-yl)acetyl]amino]-2-methylpropanoic acid.
| Compound Name | 2-[ethyl-[2-(thian-4-yl)acetyl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 83146101 |
| Molecular Formula | C13H23NO3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 2-[ethyl-[2-(thian-4-yl)acetyl]amino]-2-methylpropanoic acid |
| SMILES | CCN(C(=O)CC1CCSCC1)C(C)(C)C(=O)O |
| InChI | InChI=1S/C13H23NO3S/c1-4-14(13(2,3)12(16)17)11(15)9-10-5-7-18-8-6-10/h10H,4-9H2,1-3H3,(H,16,17) |
| InChIKey | GHZXOGJUIWAZOF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |