About 3-[1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)ethylamino]butan-1-ol
3-[1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)ethylamino]butan-1-ol (PubChem CID 83147407) has the molecular formula C14H22N4O
and a molecular weight of 262.36 g/mol. Its IUPAC name is 3-[1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)ethylamino]butan-1-ol.
Molecular Properties
| Compound Name | 3-[1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)ethylamino]butan-1-ol |
| PubChem CID | 83147407 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 3-[1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)ethylamino]butan-1-ol |
| SMILES | Cc1cc2ncc(C(C)NC(C)CCO)c(C)n2n1 |
| InChI | InChI=1S/C14H22N4O/c1-9(5-6-19)16-11(3)13-8-15-14-7-10(2)17-18(14)12(13)4/h7-9,11,16,19H,5-6H2,1-4H3 |
| InChIKey | KVGGCZPGKHEANM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)ethylamino]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)ethylamino]butan-1-ol?
The IUPAC name of 3-[1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)ethylamino]butan-1-ol (CID 83147407) is 3-[1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)ethylamino]butan-1-ol.
What is the SMILES notation for 3-[1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)ethylamino]butan-1-ol?
The canonical SMILES for 3-[1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)ethylamino]butan-1-ol is Cc1cc2ncc(C(C)NC(C)CCO)c(C)n2n1.
What is the InChIKey of 3-[1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)ethylamino]butan-1-ol?
The InChIKey is KVGGCZPGKHEANM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N4O/c1-9(5-6-19)16-11(3)13-8-15-14-7-10(2)17-18(14)12(13)4/h7-9,11,16,19H,5-6H2,1-4H3.
What are the key properties of 3-[1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)ethylamino]butan-1-ol?
3-[1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)ethylamino]butan-1-ol has a molecular weight of 262.36 g/mol, XLogP of 1.77, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(2,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)ethylamino]butan-1-ol is sourced from PubChem (CID 83147407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).