About 2-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2,3-dimethylbutanoic acid
2-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2,3-dimethylbutanoic acid (PubChem CID 83148157) has the molecular formula C14H23ClN2O2
and a molecular weight of 286.80 g/mol. Its IUPAC name is 2-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2,3-dimethylbutanoic acid.
Molecular Properties
| Compound Name | 2-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2,3-dimethylbutanoic acid |
| PubChem CID | 83148157 |
| Molecular Formula | C14H23ClN2O2 |
| Molecular Weight | 286.80 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 2-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2,3-dimethylbutanoic acid |
| SMILES | CCc1nn(CC)c(CC(C)(C(=O)O)C(C)C)c1Cl |
| InChI | InChI=1S/C14H23ClN2O2/c1-6-10-12(15)11(17(7-2)16-10)8-14(5,9(3)4)13(18)19/h9H,6-8H2,1-5H3,(H,18,19) |
| InChIKey | WZXWLIXBEAOOFP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.80 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2,3-dimethylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2,3-dimethylbutanoic acid?
The IUPAC name of 2-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2,3-dimethylbutanoic acid (CID 83148157) is 2-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2,3-dimethylbutanoic acid.
What is the SMILES notation for 2-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2,3-dimethylbutanoic acid?
The canonical SMILES for 2-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2,3-dimethylbutanoic acid is CCc1nn(CC)c(CC(C)(C(=O)O)C(C)C)c1Cl.
What is the InChIKey of 2-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2,3-dimethylbutanoic acid?
The InChIKey is WZXWLIXBEAOOFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23ClN2O2/c1-6-10-12(15)11(17(7-2)16-10)8-14(5,9(3)4)13(18)19/h9H,6-8H2,1-5H3,(H,18,19).
What are the key properties of 2-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2,3-dimethylbutanoic acid?
2-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2,3-dimethylbutanoic acid has a molecular weight of 286.80 g/mol, XLogP of 3.41, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]-2,3-dimethylbutanoic acid is sourced from PubChem (CID 83148157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).