About 4-(1-chloro-2-cyclopropylpropyl)-1,2-diethylbenzene
4-(1-chloro-2-cyclopropylpropyl)-1,2-diethylbenzene (PubChem CID 83148211) has the molecular formula C16H23Cl
and a molecular weight of 250.81 g/mol. Its IUPAC name is 4-(1-chloro-2-cyclopropylpropyl)-1,2-diethylbenzene.
Molecular Properties
| Compound Name | 4-(1-chloro-2-cyclopropylpropyl)-1,2-diethylbenzene |
| PubChem CID | 83148211 |
| Molecular Formula | C16H23Cl |
| Molecular Weight | 250.81 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 4-(1-chloro-2-cyclopropylpropyl)-1,2-diethylbenzene |
| SMILES | CCc1ccc(C(Cl)C(C)C2CC2)cc1CC |
| InChI | InChI=1S/C16H23Cl/c1-4-12-6-9-15(10-13(12)5-2)16(17)11(3)14-7-8-14/h6,9-11,14,16H,4-5,7-8H2,1-3H3 |
| InChIKey | TWIRGVHBCLLGGO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 250.81 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-chloro-2-cyclopropylpropyl)-1,2-diethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-chloro-2-cyclopropylpropyl)-1,2-diethylbenzene?
The IUPAC name of 4-(1-chloro-2-cyclopropylpropyl)-1,2-diethylbenzene (CID 83148211) is 4-(1-chloro-2-cyclopropylpropyl)-1,2-diethylbenzene.
What is the SMILES notation for 4-(1-chloro-2-cyclopropylpropyl)-1,2-diethylbenzene?
The canonical SMILES for 4-(1-chloro-2-cyclopropylpropyl)-1,2-diethylbenzene is CCc1ccc(C(Cl)C(C)C2CC2)cc1CC.
What is the InChIKey of 4-(1-chloro-2-cyclopropylpropyl)-1,2-diethylbenzene?
The InChIKey is TWIRGVHBCLLGGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23Cl/c1-4-12-6-9-15(10-13(12)5-2)16(17)11(3)14-7-8-14/h6,9-11,14,16H,4-5,7-8H2,1-3H3.
What are the key properties of 4-(1-chloro-2-cyclopropylpropyl)-1,2-diethylbenzene?
4-(1-chloro-2-cyclopropylpropyl)-1,2-diethylbenzene has a molecular weight of 250.81 g/mol, XLogP of 5.14, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-chloro-2-cyclopropylpropyl)-1,2-diethylbenzene is sourced from PubChem (CID 83148211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).