About 3-(1-bromo-2-cyclopropylpropyl)-2,5-dichlorothiophene
3-(1-bromo-2-cyclopropylpropyl)-2,5-dichlorothiophene (PubChem CID 83149199) has the molecular formula C10H11BrCl2S
and a molecular weight of 314.08 g/mol. Its IUPAC name is 3-(1-bromo-2-cyclopropylpropyl)-2,5-dichlorothiophene.
Molecular Properties
| Compound Name | 3-(1-bromo-2-cyclopropylpropyl)-2,5-dichlorothiophene |
| PubChem CID | 83149199 |
| Molecular Formula | C10H11BrCl2S |
| Molecular Weight | 314.08 g/mol |
| Exact Mass | 311.91 |
| IUPAC Name | 3-(1-bromo-2-cyclopropylpropyl)-2,5-dichlorothiophene |
| SMILES | CC(C1CC1)C(Br)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C10H11BrCl2S/c1-5(6-2-3-6)9(11)7-4-8(12)14-10(7)13/h4-6,9H,2-3H2,1H3 |
| InChIKey | ZUILDNRGDZXIJB-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.08 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-bromo-2-cyclopropylpropyl)-2,5-dichlorothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-bromo-2-cyclopropylpropyl)-2,5-dichlorothiophene?
The IUPAC name of 3-(1-bromo-2-cyclopropylpropyl)-2,5-dichlorothiophene (CID 83149199) is 3-(1-bromo-2-cyclopropylpropyl)-2,5-dichlorothiophene.
What is the SMILES notation for 3-(1-bromo-2-cyclopropylpropyl)-2,5-dichlorothiophene?
The canonical SMILES for 3-(1-bromo-2-cyclopropylpropyl)-2,5-dichlorothiophene is CC(C1CC1)C(Br)c1cc(Cl)sc1Cl.
What is the InChIKey of 3-(1-bromo-2-cyclopropylpropyl)-2,5-dichlorothiophene?
The InChIKey is ZUILDNRGDZXIJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrCl2S/c1-5(6-2-3-6)9(11)7-4-8(12)14-10(7)13/h4-6,9H,2-3H2,1H3.
What are the key properties of 3-(1-bromo-2-cyclopropylpropyl)-2,5-dichlorothiophene?
3-(1-bromo-2-cyclopropylpropyl)-2,5-dichlorothiophene has a molecular weight of 314.08 g/mol, XLogP of 5.54, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-bromo-2-cyclopropylpropyl)-2,5-dichlorothiophene is sourced from PubChem (CID 83149199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).