C13H16BrCl — CID 83151006
1-(2-bromo-3-cyclopropylbutyl)-4-chlorobenzene (PubChem CID 83151006) has the molecular formula C13H16BrCl and a molecular weight of 287.63 g/mol. Its IUPAC name is 1-(2-bromo-3-cyclopropylbutyl)-4-chlorobenzene.
| Compound Name | 1-(2-bromo-3-cyclopropylbutyl)-4-chlorobenzene |
|---|---|
| PubChem CID | 83151006 |
| Molecular Formula | C13H16BrCl |
| Molecular Weight | 287.63 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 1-(2-bromo-3-cyclopropylbutyl)-4-chlorobenzene |
| SMILES | CC(C(Br)Cc1ccc(Cl)cc1)C1CC1 |
| InChI | InChI=1S/C13H16BrCl/c1-9(11-4-5-11)13(14)8-10-2-6-12(15)7-3-10/h2-3,6-7,9,11,13H,4-5,8H2,1H3 |
| InChIKey | KRKMRNNHHRWOTI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.63 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|