About 6-phenyl-1H-pyrimidine-2,4-dithione
6-phenyl-1H-pyrimidine-2,4-dithione (PubChem CID 831515) has the molecular formula C10H8N2S2
and a molecular weight of 220.32 g/mol. Its IUPAC name is 6-phenyl-1H-pyrimidine-2,4-dithione.
Molecular Properties
| Compound Name | 6-phenyl-1H-pyrimidine-2,4-dithione |
| PubChem CID | 831515 |
| Molecular Formula | C10H8N2S2 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.01 |
| IUPAC Name | 6-phenyl-1H-pyrimidine-2,4-dithione |
| SMILES | S=c1cc(-c2ccccc2)[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C10H8N2S2/c13-9-6-8(11-10(14)12-9)7-4-2-1-3-5-7/h1-6H,(H2,11,12,13,14) |
| InChIKey | VBZZPISRUWBGKZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-phenyl-1H-pyrimidine-2,4-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenyl-1H-pyrimidine-2,4-dithione?
The IUPAC name of 6-phenyl-1H-pyrimidine-2,4-dithione (CID 831515) is 6-phenyl-1H-pyrimidine-2,4-dithione.
What is the SMILES notation for 6-phenyl-1H-pyrimidine-2,4-dithione?
The canonical SMILES for 6-phenyl-1H-pyrimidine-2,4-dithione is S=c1cc(-c2ccccc2)[nH]c(=S)[nH]1.
What is the InChIKey of 6-phenyl-1H-pyrimidine-2,4-dithione?
The InChIKey is VBZZPISRUWBGKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2S2/c13-9-6-8(11-10(14)12-9)7-4-2-1-3-5-7/h1-6H,(H2,11,12,13,14).
What are the key properties of 6-phenyl-1H-pyrimidine-2,4-dithione?
6-phenyl-1H-pyrimidine-2,4-dithione has a molecular weight of 220.32 g/mol, XLogP of 3.47, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenyl-1H-pyrimidine-2,4-dithione is sourced from PubChem (CID 831515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).