C15H30F3NO — CID 83151556
N-tert-butyl-2-methyl-2-propan-2-yl-5-(2,2,2-trifluoroethoxy)pentan-1-amine (PubChem CID 83151556) has the molecular formula C15H30F3NO and a molecular weight of 297.41 g/mol. Its IUPAC name is N-tert-butyl-2-methyl-2-propan-2-yl-5-(2,2,2-trifluoroethoxy)pentan-1-amine.
| Compound Name | N-tert-butyl-2-methyl-2-propan-2-yl-5-(2,2,2-trifluoroethoxy)pentan-1-amine |
|---|---|
| PubChem CID | 83151556 |
| Molecular Formula | C15H30F3NO |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | N-tert-butyl-2-methyl-2-propan-2-yl-5-(2,2,2-trifluoroethoxy)pentan-1-amine |
| SMILES | CC(C)C(C)(CCCOCC(F)(F)F)CNC(C)(C)C |
| InChI | InChI=1S/C15H30F3NO/c1-12(2)14(6,10-19-13(3,4)5)8-7-9-20-11-15(16,17)18/h12,19H,7-11H2,1-6H3 |
| InChIKey | RDEFSXSQRHDYCU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|