C13H24F3NO — CID 83151762
N-[2,3-dimethyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]butyl]cyclopropanamine (PubChem CID 83151762) has the molecular formula C13H24F3NO and a molecular weight of 267.33 g/mol. Its IUPAC name is N-[2,3-dimethyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]butyl]cyclopropanamine.
| Compound Name | N-[2,3-dimethyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]butyl]cyclopropanamine |
|---|---|
| PubChem CID | 83151762 |
| Molecular Formula | C13H24F3NO |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | N-[2,3-dimethyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]butyl]cyclopropanamine |
| SMILES | CC(C)C(C)(CCOCC(F)(F)F)CNC1CC1 |
| InChI | InChI=1S/C13H24F3NO/c1-10(2)12(3,8-17-11-4-5-11)6-7-18-9-13(14,15)16/h10-11,17H,4-9H2,1-3H3 |
| InChIKey | BYTXZXYJTPUUOH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|