About 4-chloro-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1,3-thiazole
4-chloro-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1,3-thiazole (PubChem CID 83151968) has the molecular formula C10H11ClN4S2
and a molecular weight of 286.81 g/mol. Its IUPAC name is 4-chloro-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1,3-thiazole.
Molecular Properties
| Compound Name | 4-chloro-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1,3-thiazole |
| PubChem CID | 83151968 |
| Molecular Formula | C10H11ClN4S2 |
| Molecular Weight | 286.81 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 4-chloro-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1,3-thiazole |
| SMILES | Clc1csc(N2CCN(c3nccs3)CC2)n1 |
| InChI | InChI=1S/C10H11ClN4S2/c11-8-7-17-10(13-8)15-4-2-14(3-5-15)9-12-1-6-16-9/h1,6-7H,2-5H2 |
| InChIKey | RJHOKCYXDTWSLW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.81 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-chloro-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1,3-thiazole?
The IUPAC name of 4-chloro-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1,3-thiazole (CID 83151968) is 4-chloro-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1,3-thiazole.
What is the SMILES notation for 4-chloro-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1,3-thiazole?
The canonical SMILES for 4-chloro-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1,3-thiazole is Clc1csc(N2CCN(c3nccs3)CC2)n1.
What is the InChIKey of 4-chloro-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1,3-thiazole?
The InChIKey is RJHOKCYXDTWSLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClN4S2/c11-8-7-17-10(13-8)15-4-2-14(3-5-15)9-12-1-6-16-9/h1,6-7H,2-5H2.
What are the key properties of 4-chloro-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1,3-thiazole?
4-chloro-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1,3-thiazole has a molecular weight of 286.81 g/mol, XLogP of 2.58, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]-1,3-thiazole is sourced from PubChem (CID 83151968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).