About [1-[(4-chloro-1,3-thiazol-2-yl)amino]cyclohexyl]methanol
[1-[(4-chloro-1,3-thiazol-2-yl)amino]cyclohexyl]methanol (PubChem CID 83152184) has the molecular formula C10H15ClN2OS
and a molecular weight of 246.76 g/mol. Its IUPAC name is [1-[(4-chloro-1,3-thiazol-2-yl)amino]cyclohexyl]methanol.
Molecular Properties
| Compound Name | [1-[(4-chloro-1,3-thiazol-2-yl)amino]cyclohexyl]methanol |
| PubChem CID | 83152184 |
| Molecular Formula | C10H15ClN2OS |
| Molecular Weight | 246.76 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | [1-[(4-chloro-1,3-thiazol-2-yl)amino]cyclohexyl]methanol |
| SMILES | OCC1(Nc2nc(Cl)cs2)CCCCC1 |
| InChI | InChI=1S/C10H15ClN2OS/c11-8-6-15-9(12-8)13-10(7-14)4-2-1-3-5-10/h6,14H,1-5,7H2,(H,12,13) |
| InChIKey | NTJAFCDEYOSHRV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.76 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[(4-chloro-1,3-thiazol-2-yl)amino]cyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(4-chloro-1,3-thiazol-2-yl)amino]cyclohexyl]methanol?
The IUPAC name of [1-[(4-chloro-1,3-thiazol-2-yl)amino]cyclohexyl]methanol (CID 83152184) is [1-[(4-chloro-1,3-thiazol-2-yl)amino]cyclohexyl]methanol.
What is the SMILES notation for [1-[(4-chloro-1,3-thiazol-2-yl)amino]cyclohexyl]methanol?
The canonical SMILES for [1-[(4-chloro-1,3-thiazol-2-yl)amino]cyclohexyl]methanol is OCC1(Nc2nc(Cl)cs2)CCCCC1.
What is the InChIKey of [1-[(4-chloro-1,3-thiazol-2-yl)amino]cyclohexyl]methanol?
The InChIKey is NTJAFCDEYOSHRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15ClN2OS/c11-8-6-15-9(12-8)13-10(7-14)4-2-1-3-5-10/h6,14H,1-5,7H2,(H,12,13).
What are the key properties of [1-[(4-chloro-1,3-thiazol-2-yl)amino]cyclohexyl]methanol?
[1-[(4-chloro-1,3-thiazol-2-yl)amino]cyclohexyl]methanol has a molecular weight of 246.76 g/mol, XLogP of 2.90, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(4-chloro-1,3-thiazol-2-yl)amino]cyclohexyl]methanol is sourced from PubChem (CID 83152184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).