About [2-[[(4-chloro-1,3-thiazol-2-yl)amino]methyl]cyclopentyl]methanol
[2-[[(4-chloro-1,3-thiazol-2-yl)amino]methyl]cyclopentyl]methanol (PubChem CID 83152429) has the molecular formula C10H15ClN2OS
and a molecular weight of 246.76 g/mol. Its IUPAC name is [2-[[(4-chloro-1,3-thiazol-2-yl)amino]methyl]cyclopentyl]methanol.
Molecular Properties
| Compound Name | [2-[[(4-chloro-1,3-thiazol-2-yl)amino]methyl]cyclopentyl]methanol |
| PubChem CID | 83152429 |
| Molecular Formula | C10H15ClN2OS |
| Molecular Weight | 246.76 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | [2-[[(4-chloro-1,3-thiazol-2-yl)amino]methyl]cyclopentyl]methanol |
| SMILES | OCC1CCCC1CNc1nc(Cl)cs1 |
| InChI | InChI=1S/C10H15ClN2OS/c11-9-6-15-10(13-9)12-4-7-2-1-3-8(7)5-14/h6-8,14H,1-5H2,(H,12,13) |
| InChIKey | JXOBYALDNWDWNZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.76 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[[(4-chloro-1,3-thiazol-2-yl)amino]methyl]cyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[[(4-chloro-1,3-thiazol-2-yl)amino]methyl]cyclopentyl]methanol?
The IUPAC name of [2-[[(4-chloro-1,3-thiazol-2-yl)amino]methyl]cyclopentyl]methanol (CID 83152429) is [2-[[(4-chloro-1,3-thiazol-2-yl)amino]methyl]cyclopentyl]methanol.
What is the SMILES notation for [2-[[(4-chloro-1,3-thiazol-2-yl)amino]methyl]cyclopentyl]methanol?
The canonical SMILES for [2-[[(4-chloro-1,3-thiazol-2-yl)amino]methyl]cyclopentyl]methanol is OCC1CCCC1CNc1nc(Cl)cs1.
What is the InChIKey of [2-[[(4-chloro-1,3-thiazol-2-yl)amino]methyl]cyclopentyl]methanol?
The InChIKey is JXOBYALDNWDWNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15ClN2OS/c11-9-6-15-10(13-9)12-4-7-2-1-3-8(7)5-14/h6-8,14H,1-5H2,(H,12,13).
What are the key properties of [2-[[(4-chloro-1,3-thiazol-2-yl)amino]methyl]cyclopentyl]methanol?
[2-[[(4-chloro-1,3-thiazol-2-yl)amino]methyl]cyclopentyl]methanol has a molecular weight of 246.76 g/mol, XLogP of 2.62, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[[(4-chloro-1,3-thiazol-2-yl)amino]methyl]cyclopentyl]methanol is sourced from PubChem (CID 83152429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).