2-[4-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]acetic acid

C10H14ClN3O2S — CID 83152482

IUPAC2-[4-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]acetic acid
SMILESO=C(O)CN1CCCN(c2nc(Cl)cs2)CC1
InChIInChI=1S/C10H14ClN3O2S/c11-8-7-17-10(12-8)14-3-1-2-13(4-5-14)6-9(15)16/h7H,1-6H2,(H,15,16)
InChIKeyOGZVFYCCSUPGFW-UHFFFAOYSA-N
MW275.76 g/mol
LogP1.39
Rot. Bonds3

About 2-[4-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]acetic acid

2-[4-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]acetic acid (PubChem CID 83152482) has the molecular formula C10H14ClN3O2S and a molecular weight of 275.76 g/mol. Its IUPAC name is 2-[4-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]acetic acid.

Molecular Properties

Compound Name2-[4-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]acetic acid
PubChem CID83152482
Molecular FormulaC10H14ClN3O2S
Molecular Weight275.76 g/mol
Exact Mass275.05
IUPAC Name2-[4-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]acetic acid
SMILESO=C(O)CN1CCCN(c2nc(Cl)cs2)CC1
InChIInChI=1S/C10H14ClN3O2S/c11-8-7-17-10(12-8)14-3-1-2-13(4-5-14)6-9(15)16/h7H,1-6H2,(H,15,16)
InChIKeyOGZVFYCCSUPGFW-UHFFFAOYSA-N
XLogP1.39
TPSA56.67 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.76
LogP ≤ 51.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[4-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]acetic acid?
The IUPAC name of 2-[4-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]acetic acid (CID 83152482) is 2-[4-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]acetic acid.
What is the SMILES notation for 2-[4-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]acetic acid?
The canonical SMILES for 2-[4-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]acetic acid is O=C(O)CN1CCCN(c2nc(Cl)cs2)CC1.
What is the InChIKey of 2-[4-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]acetic acid?
The InChIKey is OGZVFYCCSUPGFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClN3O2S/c11-8-7-17-10(12-8)14-3-1-2-13(4-5-14)6-9(15)16/h7H,1-6H2,(H,15,16).
What are the key properties of 2-[4-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]acetic acid?
2-[4-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]acetic acid has a molecular weight of 275.76 g/mol, XLogP of 1.39, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]acetic acid is sourced from PubChem (CID 83152482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).