About 2-[4-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]acetic acid
2-[4-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]acetic acid (PubChem CID 83152482) has the molecular formula C10H14ClN3O2S
and a molecular weight of 275.76 g/mol. Its IUPAC name is 2-[4-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[4-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]acetic acid |
| PubChem CID | 83152482 |
| Molecular Formula | C10H14ClN3O2S |
| Molecular Weight | 275.76 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 2-[4-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCCN(c2nc(Cl)cs2)CC1 |
| InChI | InChI=1S/C10H14ClN3O2S/c11-8-7-17-10(12-8)14-3-1-2-13(4-5-14)6-9(15)16/h7H,1-6H2,(H,15,16) |
| InChIKey | OGZVFYCCSUPGFW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.76 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]acetic acid?
The IUPAC name of 2-[4-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]acetic acid (CID 83152482) is 2-[4-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]acetic acid.
What is the SMILES notation for 2-[4-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]acetic acid?
The canonical SMILES for 2-[4-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]acetic acid is O=C(O)CN1CCCN(c2nc(Cl)cs2)CC1.
What is the InChIKey of 2-[4-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]acetic acid?
The InChIKey is OGZVFYCCSUPGFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClN3O2S/c11-8-7-17-10(12-8)14-3-1-2-13(4-5-14)6-9(15)16/h7H,1-6H2,(H,15,16).
What are the key properties of 2-[4-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]acetic acid?
2-[4-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]acetic acid has a molecular weight of 275.76 g/mol, XLogP of 1.39, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-chloro-1,3-thiazol-2-yl)-1,4-diazepan-1-yl]acetic acid is sourced from PubChem (CID 83152482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).