About 2-[(4-chloro-1,3-thiazol-2-yl)amino]-4-methylpentan-1-ol
2-[(4-chloro-1,3-thiazol-2-yl)amino]-4-methylpentan-1-ol (PubChem CID 83152646) has the molecular formula C9H15ClN2OS
and a molecular weight of 234.75 g/mol. Its IUPAC name is 2-[(4-chloro-1,3-thiazol-2-yl)amino]-4-methylpentan-1-ol.
Molecular Properties
| Compound Name | 2-[(4-chloro-1,3-thiazol-2-yl)amino]-4-methylpentan-1-ol |
| PubChem CID | 83152646 |
| Molecular Formula | C9H15ClN2OS |
| Molecular Weight | 234.75 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 2-[(4-chloro-1,3-thiazol-2-yl)amino]-4-methylpentan-1-ol |
| SMILES | CC(C)CC(CO)Nc1nc(Cl)cs1 |
| InChI | InChI=1S/C9H15ClN2OS/c1-6(2)3-7(4-13)11-9-12-8(10)5-14-9/h5-7,13H,3-4H2,1-2H3,(H,11,12) |
| InChIKey | UVJJAPTWMDUZLV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.75 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(4-chloro-1,3-thiazol-2-yl)amino]-4-methylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-chloro-1,3-thiazol-2-yl)amino]-4-methylpentan-1-ol?
The IUPAC name of 2-[(4-chloro-1,3-thiazol-2-yl)amino]-4-methylpentan-1-ol (CID 83152646) is 2-[(4-chloro-1,3-thiazol-2-yl)amino]-4-methylpentan-1-ol.
What is the SMILES notation for 2-[(4-chloro-1,3-thiazol-2-yl)amino]-4-methylpentan-1-ol?
The canonical SMILES for 2-[(4-chloro-1,3-thiazol-2-yl)amino]-4-methylpentan-1-ol is CC(C)CC(CO)Nc1nc(Cl)cs1.
What is the InChIKey of 2-[(4-chloro-1,3-thiazol-2-yl)amino]-4-methylpentan-1-ol?
The InChIKey is UVJJAPTWMDUZLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15ClN2OS/c1-6(2)3-7(4-13)11-9-12-8(10)5-14-9/h5-7,13H,3-4H2,1-2H3,(H,11,12).
What are the key properties of 2-[(4-chloro-1,3-thiazol-2-yl)amino]-4-methylpentan-1-ol?
2-[(4-chloro-1,3-thiazol-2-yl)amino]-4-methylpentan-1-ol has a molecular weight of 234.75 g/mol, XLogP of 2.62, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-chloro-1,3-thiazol-2-yl)amino]-4-methylpentan-1-ol is sourced from PubChem (CID 83152646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).