About 4-chloro-N-(2,2-dimethylheptyl)-1,3-thiazol-2-amine
4-chloro-N-(2,2-dimethylheptyl)-1,3-thiazol-2-amine (PubChem CID 83152792) has the molecular formula C12H21ClN2S
and a molecular weight of 260.83 g/mol. Its IUPAC name is 4-chloro-N-(2,2-dimethylheptyl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-chloro-N-(2,2-dimethylheptyl)-1,3-thiazol-2-amine |
| PubChem CID | 83152792 |
| Molecular Formula | C12H21ClN2S |
| Molecular Weight | 260.83 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 4-chloro-N-(2,2-dimethylheptyl)-1,3-thiazol-2-amine |
| SMILES | CCCCCC(C)(C)CNc1nc(Cl)cs1 |
| InChI | InChI=1S/C12H21ClN2S/c1-4-5-6-7-12(2,3)9-14-11-15-10(13)8-16-11/h8H,4-7,9H2,1-3H3,(H,14,15) |
| InChIKey | GYUZZMUJUAPBPO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.83 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-N-(2,2-dimethylheptyl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-(2,2-dimethylheptyl)-1,3-thiazol-2-amine?
The IUPAC name of 4-chloro-N-(2,2-dimethylheptyl)-1,3-thiazol-2-amine (CID 83152792) is 4-chloro-N-(2,2-dimethylheptyl)-1,3-thiazol-2-amine.
What is the SMILES notation for 4-chloro-N-(2,2-dimethylheptyl)-1,3-thiazol-2-amine?
The canonical SMILES for 4-chloro-N-(2,2-dimethylheptyl)-1,3-thiazol-2-amine is CCCCCC(C)(C)CNc1nc(Cl)cs1.
What is the InChIKey of 4-chloro-N-(2,2-dimethylheptyl)-1,3-thiazol-2-amine?
The InChIKey is GYUZZMUJUAPBPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21ClN2S/c1-4-5-6-7-12(2,3)9-14-11-15-10(13)8-16-11/h8H,4-7,9H2,1-3H3,(H,14,15).
What are the key properties of 4-chloro-N-(2,2-dimethylheptyl)-1,3-thiazol-2-amine?
4-chloro-N-(2,2-dimethylheptyl)-1,3-thiazol-2-amine has a molecular weight of 260.83 g/mol, XLogP of 4.81, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-(2,2-dimethylheptyl)-1,3-thiazol-2-amine is sourced from PubChem (CID 83152792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).