About 4-chloro-2-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)-1,3-thiazole
4-chloro-2-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)-1,3-thiazole (PubChem CID 83152798) has the molecular formula C13H13ClN2S
and a molecular weight of 264.78 g/mol. Its IUPAC name is 4-chloro-2-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | 4-chloro-2-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)-1,3-thiazole |
| PubChem CID | 83152798 |
| Molecular Formula | C13H13ClN2S |
| Molecular Weight | 264.78 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 4-chloro-2-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)-1,3-thiazole |
| SMILES | CC1CCc2ccccc2N1c1nc(Cl)cs1 |
| InChI | InChI=1S/C13H13ClN2S/c1-9-6-7-10-4-2-3-5-11(10)16(9)13-15-12(14)8-17-13/h2-5,8-9H,6-7H2,1H3 |
| InChIKey | REBMUWFFWQLRKG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.78 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-2-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)-1,3-thiazole?
The IUPAC name of 4-chloro-2-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)-1,3-thiazole (CID 83152798) is 4-chloro-2-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)-1,3-thiazole.
What is the SMILES notation for 4-chloro-2-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)-1,3-thiazole?
The canonical SMILES for 4-chloro-2-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)-1,3-thiazole is CC1CCc2ccccc2N1c1nc(Cl)cs1.
What is the InChIKey of 4-chloro-2-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)-1,3-thiazole?
The InChIKey is REBMUWFFWQLRKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClN2S/c1-9-6-7-10-4-2-3-5-11(10)16(9)13-15-12(14)8-17-13/h2-5,8-9H,6-7H2,1H3.
What are the key properties of 4-chloro-2-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)-1,3-thiazole?
4-chloro-2-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)-1,3-thiazole has a molecular weight of 264.78 g/mol, XLogP of 4.27, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)-1,3-thiazole is sourced from PubChem (CID 83152798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).