C10H3ClIN3O3S — CID 83153705
4-[(4-chloro-1,3-thiazol-2-yl)oxy]-3-iodo-5-nitrobenzonitrile (PubChem CID 83153705) has the molecular formula C10H3ClIN3O3S and a molecular weight of 407.58 g/mol. Its IUPAC name is 4-[(4-chloro-1,3-thiazol-2-yl)oxy]-3-iodo-5-nitrobenzonitrile.
| Compound Name | 4-[(4-chloro-1,3-thiazol-2-yl)oxy]-3-iodo-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 83153705 |
| Molecular Formula | C10H3ClIN3O3S |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 406.86 |
| IUPAC Name | 4-[(4-chloro-1,3-thiazol-2-yl)oxy]-3-iodo-5-nitrobenzonitrile |
| SMILES | N#Cc1cc(I)c(Oc2nc(Cl)cs2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H3ClIN3O3S/c11-8-4-19-10(14-8)18-9-6(12)1-5(3-13)2-7(9)15(16)17/h1-2,4H |
| InChIKey | HVHIMFDXNDWYEX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 89.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|