About 2-(1-cyclopropylethyl)-1,3-benzoxazol-6-amine
2-(1-cyclopropylethyl)-1,3-benzoxazol-6-amine (PubChem CID 83153833) has the molecular formula C12H14N2O
and a molecular weight of 202.26 g/mol. Its IUPAC name is 2-(1-cyclopropylethyl)-1,3-benzoxazol-6-amine.
Molecular Properties
| Compound Name | 2-(1-cyclopropylethyl)-1,3-benzoxazol-6-amine |
| PubChem CID | 83153833 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 2-(1-cyclopropylethyl)-1,3-benzoxazol-6-amine |
| SMILES | CC(c1nc2ccc(N)cc2o1)C1CC1 |
| InChI | InChI=1S/C12H14N2O/c1-7(8-2-3-8)12-14-10-5-4-9(13)6-11(10)15-12/h4-8H,2-3,13H2,1H3 |
| InChIKey | OWAPXVBACZQUEY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-cyclopropylethyl)-1,3-benzoxazol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-cyclopropylethyl)-1,3-benzoxazol-6-amine?
The IUPAC name of 2-(1-cyclopropylethyl)-1,3-benzoxazol-6-amine (CID 83153833) is 2-(1-cyclopropylethyl)-1,3-benzoxazol-6-amine.
What is the SMILES notation for 2-(1-cyclopropylethyl)-1,3-benzoxazol-6-amine?
The canonical SMILES for 2-(1-cyclopropylethyl)-1,3-benzoxazol-6-amine is CC(c1nc2ccc(N)cc2o1)C1CC1.
What is the InChIKey of 2-(1-cyclopropylethyl)-1,3-benzoxazol-6-amine?
The InChIKey is OWAPXVBACZQUEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O/c1-7(8-2-3-8)12-14-10-5-4-9(13)6-11(10)15-12/h4-8H,2-3,13H2,1H3.
What are the key properties of 2-(1-cyclopropylethyl)-1,3-benzoxazol-6-amine?
2-(1-cyclopropylethyl)-1,3-benzoxazol-6-amine has a molecular weight of 202.26 g/mol, XLogP of 2.92, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-cyclopropylethyl)-1,3-benzoxazol-6-amine is sourced from PubChem (CID 83153833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).