C17H20N2O6 — CID 831553
2-methoxy-5-nitro-N-[(2,3,4-trimethoxyphenyl)methyl]aniline (PubChem CID 831553) has the molecular formula C17H20N2O6 and a molecular weight of 348.36 g/mol. Its IUPAC name is 2-methoxy-5-nitro-N-[(2,3,4-trimethoxyphenyl)methyl]aniline.
| Compound Name | 2-methoxy-5-nitro-N-[(2,3,4-trimethoxyphenyl)methyl]aniline |
|---|---|
| PubChem CID | 831553 |
| Molecular Formula | C17H20N2O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 2-methoxy-5-nitro-N-[(2,3,4-trimethoxyphenyl)methyl]aniline |
| SMILES | COc1ccc([N+](=O)[O-])cc1NCc1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C17H20N2O6/c1-22-14-8-6-12(19(20)21)9-13(14)18-10-11-5-7-15(23-2)17(25-4)16(11)24-3/h5-9,18H,10H2,1-4H3 |
| InChIKey | TVYLORBPDPMJND-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|