About 4-chloro-2-(3,4-dimethylpiperazin-1-yl)-1,3-thiazole
4-chloro-2-(3,4-dimethylpiperazin-1-yl)-1,3-thiazole (PubChem CID 83155623) has the molecular formula C9H14ClN3S
and a molecular weight of 231.75 g/mol. Its IUPAC name is 4-chloro-2-(3,4-dimethylpiperazin-1-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | 4-chloro-2-(3,4-dimethylpiperazin-1-yl)-1,3-thiazole |
| PubChem CID | 83155623 |
| Molecular Formula | C9H14ClN3S |
| Molecular Weight | 231.75 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 4-chloro-2-(3,4-dimethylpiperazin-1-yl)-1,3-thiazole |
| SMILES | CC1CN(c2nc(Cl)cs2)CCN1C |
| InChI | InChI=1S/C9H14ClN3S/c1-7-5-13(4-3-12(7)2)9-11-8(10)6-14-9/h6-7H,3-5H2,1-2H3 |
| InChIKey | LOJXYMHIYOCTLP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.75 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-2-(3,4-dimethylpiperazin-1-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-(3,4-dimethylpiperazin-1-yl)-1,3-thiazole?
The IUPAC name of 4-chloro-2-(3,4-dimethylpiperazin-1-yl)-1,3-thiazole (CID 83155623) is 4-chloro-2-(3,4-dimethylpiperazin-1-yl)-1,3-thiazole.
What is the SMILES notation for 4-chloro-2-(3,4-dimethylpiperazin-1-yl)-1,3-thiazole?
The canonical SMILES for 4-chloro-2-(3,4-dimethylpiperazin-1-yl)-1,3-thiazole is CC1CN(c2nc(Cl)cs2)CCN1C.
What is the InChIKey of 4-chloro-2-(3,4-dimethylpiperazin-1-yl)-1,3-thiazole?
The InChIKey is LOJXYMHIYOCTLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14ClN3S/c1-7-5-13(4-3-12(7)2)9-11-8(10)6-14-9/h6-7H,3-5H2,1-2H3.
What are the key properties of 4-chloro-2-(3,4-dimethylpiperazin-1-yl)-1,3-thiazole?
4-chloro-2-(3,4-dimethylpiperazin-1-yl)-1,3-thiazole has a molecular weight of 231.75 g/mol, XLogP of 1.94, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(3,4-dimethylpiperazin-1-yl)-1,3-thiazole is sourced from PubChem (CID 83155623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).