C9H10ClN3O2S — CID 83155750
4-(4-chloro-1,3-thiazol-2-yl)-3,3-dimethylpiperazine-2,6-dione (PubChem CID 83155750) has the molecular formula C9H10ClN3O2S and a molecular weight of 259.72 g/mol. Its IUPAC name is 4-(4-chloro-1,3-thiazol-2-yl)-3,3-dimethylpiperazine-2,6-dione.
| Compound Name | 4-(4-chloro-1,3-thiazol-2-yl)-3,3-dimethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 83155750 |
| Molecular Formula | C9H10ClN3O2S |
| Molecular Weight | 259.72 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 4-(4-chloro-1,3-thiazol-2-yl)-3,3-dimethylpiperazine-2,6-dione |
| SMILES | CC1(C)C(=O)NC(=O)CN1c1nc(Cl)cs1 |
| InChI | InChI=1S/C9H10ClN3O2S/c1-9(2)7(15)12-6(14)3-13(9)8-11-5(10)4-16-8/h4H,3H2,1-2H3,(H,12,14,15) |
| InChIKey | IPKUHSPJNZTVAI-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.72 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|