C14H22ClN — CID 83155903
N-[(1S)-1-(3-chlorophenyl)ethyl]-4-methylpentan-1-amine (PubChem CID 83155903) has the molecular formula C14H22ClN and a molecular weight of 239.79 g/mol. Its IUPAC name is N-[(1S)-1-(3-chlorophenyl)ethyl]-4-methylpentan-1-amine.
| Compound Name | N-[(1S)-1-(3-chlorophenyl)ethyl]-4-methylpentan-1-amine |
|---|---|
| PubChem CID | 83155903 |
| Molecular Formula | C14H22ClN |
| Molecular Weight | 239.79 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | N-[(1S)-1-(3-chlorophenyl)ethyl]-4-methylpentan-1-amine |
| SMILES | CC(C)CCCN[C@@H](C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H22ClN/c1-11(2)6-5-9-16-12(3)13-7-4-8-14(15)10-13/h4,7-8,10-12,16H,5-6,9H2,1-3H3/t12-/m0/s1 |
| InChIKey | NEHVOVAMTCNMTJ-LBPRGKRZSA-N |
| XLogP | 4.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.79 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|