About 4-chloro-N-methyl-N-(3-methylbutan-2-yl)-1,3-thiazol-2-amine
4-chloro-N-methyl-N-(3-methylbutan-2-yl)-1,3-thiazol-2-amine (PubChem CID 83155951) has the molecular formula C9H15ClN2S
and a molecular weight of 218.75 g/mol. Its IUPAC name is 4-chloro-N-methyl-N-(3-methylbutan-2-yl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-chloro-N-methyl-N-(3-methylbutan-2-yl)-1,3-thiazol-2-amine |
| PubChem CID | 83155951 |
| Molecular Formula | C9H15ClN2S |
| Molecular Weight | 218.75 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 4-chloro-N-methyl-N-(3-methylbutan-2-yl)-1,3-thiazol-2-amine |
| SMILES | CC(C)C(C)N(C)c1nc(Cl)cs1 |
| InChI | InChI=1S/C9H15ClN2S/c1-6(2)7(3)12(4)9-11-8(10)5-13-9/h5-7H,1-4H3 |
| InChIKey | REZAOQGOSBEFKP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.75 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-N-methyl-N-(3-methylbutan-2-yl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-methyl-N-(3-methylbutan-2-yl)-1,3-thiazol-2-amine?
The IUPAC name of 4-chloro-N-methyl-N-(3-methylbutan-2-yl)-1,3-thiazol-2-amine (CID 83155951) is 4-chloro-N-methyl-N-(3-methylbutan-2-yl)-1,3-thiazol-2-amine.
What is the SMILES notation for 4-chloro-N-methyl-N-(3-methylbutan-2-yl)-1,3-thiazol-2-amine?
The canonical SMILES for 4-chloro-N-methyl-N-(3-methylbutan-2-yl)-1,3-thiazol-2-amine is CC(C)C(C)N(C)c1nc(Cl)cs1.
What is the InChIKey of 4-chloro-N-methyl-N-(3-methylbutan-2-yl)-1,3-thiazol-2-amine?
The InChIKey is REZAOQGOSBEFKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15ClN2S/c1-6(2)7(3)12(4)9-11-8(10)5-13-9/h5-7H,1-4H3.
What are the key properties of 4-chloro-N-methyl-N-(3-methylbutan-2-yl)-1,3-thiazol-2-amine?
4-chloro-N-methyl-N-(3-methylbutan-2-yl)-1,3-thiazol-2-amine has a molecular weight of 218.75 g/mol, XLogP of 3.28, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-methyl-N-(3-methylbutan-2-yl)-1,3-thiazol-2-amine is sourced from PubChem (CID 83155951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).