About 2-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]-5-methylsulfanyl-1,3,4-thiadiazole
2-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]-5-methylsulfanyl-1,3,4-thiadiazole (PubChem CID 83156513) has the molecular formula C6H4ClN3S4
and a molecular weight of 281.84 g/mol. Its IUPAC name is 2-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]-5-methylsulfanyl-1,3,4-thiadiazole.
Molecular Properties
| Compound Name | 2-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]-5-methylsulfanyl-1,3,4-thiadiazole |
| PubChem CID | 83156513 |
| Molecular Formula | C6H4ClN3S4 |
| Molecular Weight | 281.84 g/mol |
| Exact Mass | 280.90 |
| IUPAC Name | 2-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]-5-methylsulfanyl-1,3,4-thiadiazole |
| SMILES | CSc1nnc(Sc2nc(Cl)cs2)s1 |
| InChI | InChI=1S/C6H4ClN3S4/c1-11-5-9-10-6(14-5)13-4-8-3(7)2-12-4/h2H,1H3 |
| InChIKey | SQHCLUWTLKEECU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.84 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]-5-methylsulfanyl-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]-5-methylsulfanyl-1,3,4-thiadiazole?
The IUPAC name of 2-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]-5-methylsulfanyl-1,3,4-thiadiazole (CID 83156513) is 2-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]-5-methylsulfanyl-1,3,4-thiadiazole.
What is the SMILES notation for 2-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]-5-methylsulfanyl-1,3,4-thiadiazole?
The canonical SMILES for 2-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]-5-methylsulfanyl-1,3,4-thiadiazole is CSc1nnc(Sc2nc(Cl)cs2)s1.
What is the InChIKey of 2-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]-5-methylsulfanyl-1,3,4-thiadiazole?
The InChIKey is SQHCLUWTLKEECU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClN3S4/c1-11-5-9-10-6(14-5)13-4-8-3(7)2-12-4/h2H,1H3.
What are the key properties of 2-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]-5-methylsulfanyl-1,3,4-thiadiazole?
2-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]-5-methylsulfanyl-1,3,4-thiadiazole has a molecular weight of 281.84 g/mol, XLogP of 3.52, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]-5-methylsulfanyl-1,3,4-thiadiazole is sourced from PubChem (CID 83156513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).