About 2-N-(4-chloro-1,3-thiazol-2-yl)propane-1,2-diamine
2-N-(4-chloro-1,3-thiazol-2-yl)propane-1,2-diamine (PubChem CID 83156525) has the molecular formula C6H10ClN3S
and a molecular weight of 191.69 g/mol. Its IUPAC name is 2-N-(4-chloro-1,3-thiazol-2-yl)propane-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-(4-chloro-1,3-thiazol-2-yl)propane-1,2-diamine |
| PubChem CID | 83156525 |
| Molecular Formula | C6H10ClN3S |
| Molecular Weight | 191.69 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | 2-N-(4-chloro-1,3-thiazol-2-yl)propane-1,2-diamine |
| SMILES | CC(CN)Nc1nc(Cl)cs1 |
| InChI | InChI=1S/C6H10ClN3S/c1-4(2-8)9-6-10-5(7)3-11-6/h3-4H,2,8H2,1H3,(H,9,10) |
| InChIKey | JGOGXQJIECHWDB-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.69 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-N-(4-chloro-1,3-thiazol-2-yl)propane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(4-chloro-1,3-thiazol-2-yl)propane-1,2-diamine?
The IUPAC name of 2-N-(4-chloro-1,3-thiazol-2-yl)propane-1,2-diamine (CID 83156525) is 2-N-(4-chloro-1,3-thiazol-2-yl)propane-1,2-diamine.
What is the SMILES notation for 2-N-(4-chloro-1,3-thiazol-2-yl)propane-1,2-diamine?
The canonical SMILES for 2-N-(4-chloro-1,3-thiazol-2-yl)propane-1,2-diamine is CC(CN)Nc1nc(Cl)cs1.
What is the InChIKey of 2-N-(4-chloro-1,3-thiazol-2-yl)propane-1,2-diamine?
The InChIKey is JGOGXQJIECHWDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10ClN3S/c1-4(2-8)9-6-10-5(7)3-11-6/h3-4H,2,8H2,1H3,(H,9,10).
What are the key properties of 2-N-(4-chloro-1,3-thiazol-2-yl)propane-1,2-diamine?
2-N-(4-chloro-1,3-thiazol-2-yl)propane-1,2-diamine has a molecular weight of 191.69 g/mol, XLogP of 1.56, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(4-chloro-1,3-thiazol-2-yl)propane-1,2-diamine is sourced from PubChem (CID 83156525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).