About 3-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]butan-1-ol
3-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]butan-1-ol (PubChem CID 83157118) has the molecular formula C7H10ClNOS2
and a molecular weight of 223.75 g/mol. Its IUPAC name is 3-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]butan-1-ol.
Molecular Properties
| Compound Name | 3-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]butan-1-ol |
| PubChem CID | 83157118 |
| Molecular Formula | C7H10ClNOS2 |
| Molecular Weight | 223.75 g/mol |
| Exact Mass | 222.99 |
| IUPAC Name | 3-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]butan-1-ol |
| SMILES | CC(CCO)Sc1nc(Cl)cs1 |
| InChI | InChI=1S/C7H10ClNOS2/c1-5(2-3-10)12-7-9-6(8)4-11-7/h4-5,10H,2-3H2,1H3 |
| InChIKey | QTPXEFSXKQXOMW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.75 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]butan-1-ol?
The IUPAC name of 3-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]butan-1-ol (CID 83157118) is 3-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]butan-1-ol.
What is the SMILES notation for 3-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]butan-1-ol?
The canonical SMILES for 3-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]butan-1-ol is CC(CCO)Sc1nc(Cl)cs1.
What is the InChIKey of 3-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]butan-1-ol?
The InChIKey is QTPXEFSXKQXOMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10ClNOS2/c1-5(2-3-10)12-7-9-6(8)4-11-7/h4-5,10H,2-3H2,1H3.
What are the key properties of 3-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]butan-1-ol?
3-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]butan-1-ol has a molecular weight of 223.75 g/mol, XLogP of 2.66, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]butan-1-ol is sourced from PubChem (CID 83157118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).