C11H10ClFN2S — CID 83157193
4-chloro-N-ethyl-N-(2-fluorophenyl)-1,3-thiazol-2-amine (PubChem CID 83157193) has the molecular formula C11H10ClFN2S and a molecular weight of 256.73 g/mol. Its IUPAC name is 4-chloro-N-ethyl-N-(2-fluorophenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-chloro-N-ethyl-N-(2-fluorophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 83157193 |
| Molecular Formula | C11H10ClFN2S |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 4-chloro-N-ethyl-N-(2-fluorophenyl)-1,3-thiazol-2-amine |
| SMILES | CCN(c1nc(Cl)cs1)c1ccccc1F |
| InChI | InChI=1S/C11H10ClFN2S/c1-2-15(11-14-10(12)7-16-11)9-6-4-3-5-8(9)13/h3-7H,2H2,1H3 |
| InChIKey | LQACXENWRBPSIU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |