About 4-chloro-N-(4,4-dimethylcyclohexyl)-N-methyl-1,3-thiazol-2-amine
4-chloro-N-(4,4-dimethylcyclohexyl)-N-methyl-1,3-thiazol-2-amine (PubChem CID 83157215) has the molecular formula C12H19ClN2S
and a molecular weight of 258.82 g/mol. Its IUPAC name is 4-chloro-N-(4,4-dimethylcyclohexyl)-N-methyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-chloro-N-(4,4-dimethylcyclohexyl)-N-methyl-1,3-thiazol-2-amine |
| PubChem CID | 83157215 |
| Molecular Formula | C12H19ClN2S |
| Molecular Weight | 258.82 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 4-chloro-N-(4,4-dimethylcyclohexyl)-N-methyl-1,3-thiazol-2-amine |
| SMILES | CN(c1nc(Cl)cs1)C1CCC(C)(C)CC1 |
| InChI | InChI=1S/C12H19ClN2S/c1-12(2)6-4-9(5-7-12)15(3)11-14-10(13)8-16-11/h8-9H,4-7H2,1-3H3 |
| InChIKey | SATTWPKTVHGACP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.82 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-N-(4,4-dimethylcyclohexyl)-N-methyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-(4,4-dimethylcyclohexyl)-N-methyl-1,3-thiazol-2-amine?
The IUPAC name of 4-chloro-N-(4,4-dimethylcyclohexyl)-N-methyl-1,3-thiazol-2-amine (CID 83157215) is 4-chloro-N-(4,4-dimethylcyclohexyl)-N-methyl-1,3-thiazol-2-amine.
What is the SMILES notation for 4-chloro-N-(4,4-dimethylcyclohexyl)-N-methyl-1,3-thiazol-2-amine?
The canonical SMILES for 4-chloro-N-(4,4-dimethylcyclohexyl)-N-methyl-1,3-thiazol-2-amine is CN(c1nc(Cl)cs1)C1CCC(C)(C)CC1.
What is the InChIKey of 4-chloro-N-(4,4-dimethylcyclohexyl)-N-methyl-1,3-thiazol-2-amine?
The InChIKey is SATTWPKTVHGACP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19ClN2S/c1-12(2)6-4-9(5-7-12)15(3)11-14-10(13)8-16-11/h8-9H,4-7H2,1-3H3.
What are the key properties of 4-chloro-N-(4,4-dimethylcyclohexyl)-N-methyl-1,3-thiazol-2-amine?
4-chloro-N-(4,4-dimethylcyclohexyl)-N-methyl-1,3-thiazol-2-amine has a molecular weight of 258.82 g/mol, XLogP of 4.20, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-(4,4-dimethylcyclohexyl)-N-methyl-1,3-thiazol-2-amine is sourced from PubChem (CID 83157215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).