ethyl 2-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]acetate

C7H8ClNO2S2 — CID 83157230

IUPACethyl 2-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]acetate
SMILESCCOC(=O)CSc1nc(Cl)cs1
InChIInChI=1S/C7H8ClNO2S2/c1-2-11-6(10)4-13-7-9-5(8)3-12-7/h3H,2,4H2,1H3
InChIKeyAMZMQEATAOQBDI-UHFFFAOYSA-N
MW237.73 g/mol
LogP2.45
Rot. Bonds4

About ethyl 2-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]acetate

ethyl 2-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]acetate (PubChem CID 83157230) has the molecular formula C7H8ClNO2S2 and a molecular weight of 237.73 g/mol. Its IUPAC name is ethyl 2-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]acetate.

Molecular Properties

Compound Nameethyl 2-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]acetate
PubChem CID83157230
Molecular FormulaC7H8ClNO2S2
Molecular Weight237.73 g/mol
Exact Mass236.97
IUPAC Nameethyl 2-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]acetate
SMILESCCOC(=O)CSc1nc(Cl)cs1
InChIInChI=1S/C7H8ClNO2S2/c1-2-11-6(10)4-13-7-9-5(8)3-12-7/h3H,2,4H2,1H3
InChIKeyAMZMQEATAOQBDI-UHFFFAOYSA-N
XLogP2.45
TPSA39.19 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.73
LogP ≤ 52.45
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze ethyl 2-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]acetate?
The IUPAC name of ethyl 2-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]acetate (CID 83157230) is ethyl 2-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]acetate.
What is the SMILES notation for ethyl 2-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]acetate?
The canonical SMILES for ethyl 2-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]acetate is CCOC(=O)CSc1nc(Cl)cs1.
What is the InChIKey of ethyl 2-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]acetate?
The InChIKey is AMZMQEATAOQBDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClNO2S2/c1-2-11-6(10)4-13-7-9-5(8)3-12-7/h3H,2,4H2,1H3.
What are the key properties of ethyl 2-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]acetate?
ethyl 2-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]acetate has a molecular weight of 237.73 g/mol, XLogP of 2.45, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(4-chloro-1,3-thiazol-2-yl)sulfanyl]acetate is sourced from PubChem (CID 83157230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).