About 4-chloro-N-ethyl-1,3-thiazol-2-amine
4-chloro-N-ethyl-1,3-thiazol-2-amine (PubChem CID 83157418) has the molecular formula C5H7ClN2S
and a molecular weight of 162.65 g/mol. Its IUPAC name is 4-chloro-N-ethyl-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-chloro-N-ethyl-1,3-thiazol-2-amine |
| PubChem CID | 83157418 |
| Molecular Formula | C5H7ClN2S |
| Molecular Weight | 162.65 g/mol |
| Exact Mass | 162.00 |
| IUPAC Name | 4-chloro-N-ethyl-1,3-thiazol-2-amine |
| SMILES | CCNc1nc(Cl)cs1 |
| InChI | InChI=1S/C5H7ClN2S/c1-2-7-5-8-4(6)3-9-5/h3H,2H2,1H3,(H,7,8) |
| InChIKey | WMLSIINMMPJHTC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.65 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-N-ethyl-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-ethyl-1,3-thiazol-2-amine?
The IUPAC name of 4-chloro-N-ethyl-1,3-thiazol-2-amine (CID 83157418) is 4-chloro-N-ethyl-1,3-thiazol-2-amine.
What is the SMILES notation for 4-chloro-N-ethyl-1,3-thiazol-2-amine?
The canonical SMILES for 4-chloro-N-ethyl-1,3-thiazol-2-amine is CCNc1nc(Cl)cs1.
What is the InChIKey of 4-chloro-N-ethyl-1,3-thiazol-2-amine?
The InChIKey is WMLSIINMMPJHTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClN2S/c1-2-7-5-8-4(6)3-9-5/h3H,2H2,1H3,(H,7,8).
What are the key properties of 4-chloro-N-ethyl-1,3-thiazol-2-amine?
4-chloro-N-ethyl-1,3-thiazol-2-amine has a molecular weight of 162.65 g/mol, XLogP of 2.23, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-ethyl-1,3-thiazol-2-amine is sourced from PubChem (CID 83157418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).