About 5-[(4-chloro-1,3-thiazol-2-yl)oxy]-1-phenylpyrazole-4-carboxylic acid
5-[(4-chloro-1,3-thiazol-2-yl)oxy]-1-phenylpyrazole-4-carboxylic acid (PubChem CID 83157854) has the molecular formula C13H8ClN3O3S
and a molecular weight of 321.75 g/mol. Its IUPAC name is 5-[(4-chloro-1,3-thiazol-2-yl)oxy]-1-phenylpyrazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(4-chloro-1,3-thiazol-2-yl)oxy]-1-phenylpyrazole-4-carboxylic acid |
| PubChem CID | 83157854 |
| Molecular Formula | C13H8ClN3O3S |
| Molecular Weight | 321.75 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | 5-[(4-chloro-1,3-thiazol-2-yl)oxy]-1-phenylpyrazole-4-carboxylic acid |
| SMILES | O=C(O)c1cnn(-c2ccccc2)c1Oc1nc(Cl)cs1 |
| InChI | InChI=1S/C13H8ClN3O3S/c14-10-7-21-13(16-10)20-11-9(12(18)19)6-15-17(11)8-4-2-1-3-5-8/h1-7H,(H,18,19) |
| InChIKey | KVUBKYCXNLTFAZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.75 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[(4-chloro-1,3-thiazol-2-yl)oxy]-1-phenylpyrazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4-chloro-1,3-thiazol-2-yl)oxy]-1-phenylpyrazole-4-carboxylic acid?
The IUPAC name of 5-[(4-chloro-1,3-thiazol-2-yl)oxy]-1-phenylpyrazole-4-carboxylic acid (CID 83157854) is 5-[(4-chloro-1,3-thiazol-2-yl)oxy]-1-phenylpyrazole-4-carboxylic acid.
What is the SMILES notation for 5-[(4-chloro-1,3-thiazol-2-yl)oxy]-1-phenylpyrazole-4-carboxylic acid?
The canonical SMILES for 5-[(4-chloro-1,3-thiazol-2-yl)oxy]-1-phenylpyrazole-4-carboxylic acid is O=C(O)c1cnn(-c2ccccc2)c1Oc1nc(Cl)cs1.
What is the InChIKey of 5-[(4-chloro-1,3-thiazol-2-yl)oxy]-1-phenylpyrazole-4-carboxylic acid?
The InChIKey is KVUBKYCXNLTFAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8ClN3O3S/c14-10-7-21-13(16-10)20-11-9(12(18)19)6-15-17(11)8-4-2-1-3-5-8/h1-7H,(H,18,19).
What are the key properties of 5-[(4-chloro-1,3-thiazol-2-yl)oxy]-1-phenylpyrazole-4-carboxylic acid?
5-[(4-chloro-1,3-thiazol-2-yl)oxy]-1-phenylpyrazole-4-carboxylic acid has a molecular weight of 321.75 g/mol, XLogP of 3.47, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-chloro-1,3-thiazol-2-yl)oxy]-1-phenylpyrazole-4-carboxylic acid is sourced from PubChem (CID 83157854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).