C14H22BrN — CID 83158078
2-(3-bromophenyl)-6-methylheptan-2-amine (PubChem CID 83158078) has the molecular formula C14H22BrN and a molecular weight of 284.24 g/mol. Its IUPAC name is 2-(3-bromophenyl)-6-methylheptan-2-amine.
| Compound Name | 2-(3-bromophenyl)-6-methylheptan-2-amine |
|---|---|
| PubChem CID | 83158078 |
| Molecular Formula | C14H22BrN |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 2-(3-bromophenyl)-6-methylheptan-2-amine |
| SMILES | CC(C)CCCC(C)(N)c1cccc(Br)c1 |
| InChI | InChI=1S/C14H22BrN/c1-11(2)6-5-9-14(3,16)12-7-4-8-13(15)10-12/h4,7-8,10-11H,5-6,9,16H2,1-3H3 |
| InChIKey | IQPHTKQSMPFTGK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |