C11H22F3NO — CID 83159197
N,2,3-trimethyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]butan-1-amine (PubChem CID 83159197) has the molecular formula C11H22F3NO and a molecular weight of 241.30 g/mol. Its IUPAC name is N,2,3-trimethyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]butan-1-amine.
| Compound Name | N,2,3-trimethyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]butan-1-amine |
|---|---|
| PubChem CID | 83159197 |
| Molecular Formula | C11H22F3NO |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | N,2,3-trimethyl-2-[2-(2,2,2-trifluoroethoxy)ethyl]butan-1-amine |
| SMILES | CNCC(C)(CCOCC(F)(F)F)C(C)C |
| InChI | InChI=1S/C11H22F3NO/c1-9(2)10(3,7-15-4)5-6-16-8-11(12,13)14/h9,15H,5-8H2,1-4H3 |
| InChIKey | VJJLIOJXUMHYIO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|